C26H15NO5S2 — CID 5037575
5-[5-(anthracen-9-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzene-1,3-dicarboxylic acid (PubChem CID 5037575) has the molecular formula C26H15NO5S2 and a molecular weight of 485.54 g/mol. Its IUPAC name is 5-[5-(anthracen-9-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[5-(anthracen-9-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 5037575 |
| Molecular Formula | C26H15NO5S2 |
| Molecular Weight | 485.54 g/mol |
| Exact Mass | 485.04 |
| IUPAC Name | 5-[5-(anthracen-9-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1cc(C(=O)O)cc(N2C(=O)C(=Cc3c4ccccc4cc4ccccc34)SC2=S)c1 |
| InChI | InChI=1S/C26H15NO5S2/c28-23-22(13-21-19-7-3-1-5-14(19)9-15-6-2-4-8-20(15)21)34-26(33)27(23)18-11-16(24(29)30)10-17(12-18)25(31)32/h1-13H,(H,29,30)(H,31,32) |
| InChIKey | RBURBRUWEUGAGJ-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.54 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|