C21H23F2N3O2 — CID 47645078
N'-(3,4-difluorophenyl)-N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-N'-methyloxamide (PubChem CID 47645078) has the molecular formula C21H23F2N3O2 and a molecular weight of 387.43 g/mol. Its IUPAC name is N'-(3,4-difluorophenyl)-N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-N'-methyloxamide.
| Compound Name | N'-(3,4-difluorophenyl)-N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-N'-methyloxamide |
|---|---|
| PubChem CID | 47645078 |
| Molecular Formula | C21H23F2N3O2 |
| Molecular Weight | 387.43 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | N'-(3,4-difluorophenyl)-N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-N'-methyloxamide |
| SMILES | CN(C(=O)C(=O)NCCCN1CCc2ccccc2C1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C21H23F2N3O2/c1-25(17-7-8-18(22)19(23)13-17)21(28)20(27)24-10-4-11-26-12-9-15-5-2-3-6-16(15)14-26/h2-3,5-8,13H,4,9-12,14H2,1H3,(H,24,27) |
| InChIKey | OGJIEORVVHCDSA-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.43 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|