C27H23NO5 — CID 4767089
5-[(4-ethylphenoxy)methyl]-N-(2-methoxydibenzofuran-3-yl)furan-2-carboxamide (PubChem CID 4767089) has the molecular formula C27H23NO5 and a molecular weight of 441.48 g/mol. Its IUPAC name is 5-[(4-ethylphenoxy)methyl]-N-(2-methoxydibenzofuran-3-yl)furan-2-carboxamide.
| Compound Name | 5-[(4-ethylphenoxy)methyl]-N-(2-methoxydibenzofuran-3-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 4767089 |
| Molecular Formula | C27H23NO5 |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | 5-[(4-ethylphenoxy)methyl]-N-(2-methoxydibenzofuran-3-yl)furan-2-carboxamide |
| SMILES | CCc1ccc(OCc2ccc(C(=O)Nc3cc4oc5ccccc5c4cc3OC)o2)cc1 |
| InChI | InChI=1S/C27H23NO5/c1-3-17-8-10-18(11-9-17)31-16-19-12-13-24(32-19)27(29)28-22-15-25-21(14-26(22)30-2)20-6-4-5-7-23(20)33-25/h4-15H,3,16H2,1-2H3,(H,28,29) |
| InChIKey | LTAGVIOFYHKAKQ-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 73.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |