C13H11ClF3N3 — CID 4767484
7-[chloro(difluoro)methyl]-5-(4-fluorophenyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine (PubChem CID 4767484) has the molecular formula C13H11ClF3N3 and a molecular weight of 301.70 g/mol. Its IUPAC name is 7-[chloro(difluoro)methyl]-5-(4-fluorophenyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine.
| Compound Name | 7-[chloro(difluoro)methyl]-5-(4-fluorophenyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 4767484 |
| Molecular Formula | C13H11ClF3N3 |
| Molecular Weight | 301.70 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | 7-[chloro(difluoro)methyl]-5-(4-fluorophenyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine |
| SMILES | Fc1ccc(C2CC(C(F)(F)Cl)n3nccc3N2)cc1 |
| InChI | InChI=1S/C13H11ClF3N3/c14-13(16,17)11-7-10(8-1-3-9(15)4-2-8)19-12-5-6-18-20(11)12/h1-6,10-11,19H,7H2 |
| InChIKey | NRRGYTCDQCVTCU-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.70 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|