C24H29N3O2 — CID 47727451
1-(2-phenylacetyl)-N-(3-piperidin-1-ylphenyl)pyrrolidine-2-carboxamide (PubChem CID 47727451) has the molecular formula C24H29N3O2 and a molecular weight of 391.51 g/mol. Its IUPAC name is 1-(2-phenylacetyl)-N-(3-piperidin-1-ylphenyl)pyrrolidine-2-carboxamide.
| Compound Name | 1-(2-phenylacetyl)-N-(3-piperidin-1-ylphenyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 47727451 |
| Molecular Formula | C24H29N3O2 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | 1-(2-phenylacetyl)-N-(3-piperidin-1-ylphenyl)pyrrolidine-2-carboxamide |
| SMILES | O=C(Nc1cccc(N2CCCCC2)c1)C1CCCN1C(=O)Cc1ccccc1 |
| InChI | InChI=1S/C24H29N3O2/c28-23(17-19-9-3-1-4-10-19)27-16-8-13-22(27)24(29)25-20-11-7-12-21(18-20)26-14-5-2-6-15-26/h1,3-4,7,9-12,18,22H,2,5-6,8,13-17H2,(H,25,29) |
| InChIKey | ZANIXRWNADGGEX-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |