C34H31N3O3 — CID 58768832
(2S)-N-[4-[(E)-2-(4-benzamidophenyl)ethenyl]phenyl]-1-(2-phenylacetyl)pyrrolidine-2-carboxamide (PubChem CID 58768832) has the molecular formula C34H31N3O3 and a molecular weight of 529.64 g/mol. Its IUPAC name is (2S)-N-[4-[(E)-2-(4-benzamidophenyl)ethenyl]phenyl]-1-(2-phenylacetyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[4-[(E)-2-(4-benzamidophenyl)ethenyl]phenyl]-1-(2-phenylacetyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 58768832 |
| Molecular Formula | C34H31N3O3 |
| Molecular Weight | 529.64 g/mol |
| Exact Mass | 529.24 |
| IUPAC Name | (2S)-N-[4-[(E)-2-(4-benzamidophenyl)ethenyl]phenyl]-1-(2-phenylacetyl)pyrrolidine-2-carboxamide |
| SMILES | O=C(Nc1ccc(/C=C/c2ccc(NC(=O)[C@@H]3CCCN3C(=O)Cc3ccccc3)cc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C34H31N3O3/c38-32(24-27-8-3-1-4-9-27)37-23-7-12-31(37)34(40)36-30-21-17-26(18-22-30)14-13-25-15-19-29(20-16-25)35-33(39)28-10-5-2-6-11-28/h1-6,8-11,13-22,31H,7,12,23-24H2,(H,35,39)(H,36,40)/b14-13+/t31-/m0/s1 |
| InChIKey | SLCXEJJNTCIBGZ-WQEHWUEJSA-N |
| XLogP | 6.28 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.64 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|