C40H39N7O4 — CID 58768770
(2S)-N-[4-[(E)-2-[4-[[(2S)-1-[2-(3-azidophenyl)acetyl]pyrrolidine-2-carbonyl]amino]phenyl]ethenyl]phenyl]-1-(2-phenylacetyl)pyrrolidine-2-carboxamide (PubChem CID 58768770) has the molecular formula C40H39N7O4 and a molecular weight of 681.80 g/mol. Its IUPAC name is (2S)-N-[4-[(E)-2-[4-[[(2S)-1-[2-(3-azidophenyl)acetyl]pyrrolidine-2-carbonyl]amino]phenyl]ethenyl]phenyl]-1-(2-phenylacetyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[4-[(E)-2-[4-[[(2S)-1-[2-(3-azidophenyl)acetyl]pyrrolidine-2-carbonyl]amino]phenyl]ethenyl]phenyl]-1-(2-phenylacetyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 58768770 |
| Molecular Formula | C40H39N7O4 |
| Molecular Weight | 681.80 g/mol |
| Exact Mass | 681.31 |
| IUPAC Name | (2S)-N-[4-[(E)-2-[4-[[(2S)-1-[2-(3-azidophenyl)acetyl]pyrrolidine-2-carbonyl]amino]phenyl]ethenyl]phenyl]-1-(2-phenylacetyl)pyrrolidine-2-carboxamide |
| SMILES | [N-]=[N+]=Nc1cccc(CC(=O)N2CCC[C@H]2C(=O)Nc2ccc(/C=C/c3ccc(NC(=O)[C@@H]4CCCN4C(=O)Cc4ccccc4)cc3)cc2)c1 |
| InChI | InChI=1S/C40H39N7O4/c41-45-44-34-10-4-9-31(25-34)27-38(49)47-24-6-12-36(47)40(51)43-33-21-17-29(18-22-33)14-13-28-15-19-32(20-16-28)42-39(50)35-11-5-23-46(35)37(48)26-30-7-2-1-3-8-30/h1-4,7-10,13-22,25,35-36H,5-6,11-12,23-24,26-27H2,(H,42,50)(H,43,51)/b14-13+/t35-,36-/m0/s1 |
| InChIKey | CMRQQBKRSYCGDX-MDSLTQGXSA-N |
| XLogP | 7.14 |
| TPSA | 147.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.80 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|