C36H39N3O4 — CID 143367439
N-[4-[(E)-2-[4-[[(1R)-3-acetylcyclohexanecarbonyl]amino]phenyl]ethenyl]phenyl]-1-(2-phenylacetyl)pyrrolidine-2-carboxamide (PubChem CID 143367439) has the molecular formula C36H39N3O4 and a molecular weight of 577.73 g/mol. Its IUPAC name is N-[4-[(E)-2-[4-[[(1R)-3-acetylcyclohexanecarbonyl]amino]phenyl]ethenyl]phenyl]-1-(2-phenylacetyl)pyrrolidine-2-carboxamide.
| Compound Name | N-[4-[(E)-2-[4-[[(1R)-3-acetylcyclohexanecarbonyl]amino]phenyl]ethenyl]phenyl]-1-(2-phenylacetyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 143367439 |
| Molecular Formula | C36H39N3O4 |
| Molecular Weight | 577.73 g/mol |
| Exact Mass | 577.29 |
| IUPAC Name | N-[4-[(E)-2-[4-[[(1R)-3-acetylcyclohexanecarbonyl]amino]phenyl]ethenyl]phenyl]-1-(2-phenylacetyl)pyrrolidine-2-carboxamide |
| SMILES | CC(=O)C1CCC[C@@H](C(=O)Nc2ccc(/C=C/c3ccc(NC(=O)C4CCCN4C(=O)Cc4ccccc4)cc3)cc2)C1 |
| InChI | InChI=1S/C36H39N3O4/c1-25(40)29-9-5-10-30(24-29)35(42)37-31-18-14-26(15-19-31)12-13-27-16-20-32(21-17-27)38-36(43)33-11-6-22-39(33)34(41)23-28-7-3-2-4-8-28/h2-4,7-8,12-21,29-30,33H,5-6,9-11,22-24H2,1H3,(H,37,42)(H,38,43)/b13-12+/t29?,30-,33?/m1/s1 |
| InChIKey | WEELVSDQJFMNBL-OLFJKMPFSA-N |
| XLogP | 6.36 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.73 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|