C13H19BrN4O — CID 4773024
4-bromo-N-(cyclohexylmethylideneamino)-1,3-dimethylpyrazole-5-carboxamide (PubChem CID 4773024) has the molecular formula C13H19BrN4O and a molecular weight of 327.23 g/mol. Its IUPAC name is 4-bromo-N-(cyclohexylmethylideneamino)-1,3-dimethylpyrazole-5-carboxamide.
| Compound Name | 4-bromo-N-(cyclohexylmethylideneamino)-1,3-dimethylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 4773024 |
| Molecular Formula | C13H19BrN4O |
| Molecular Weight | 327.23 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | 4-bromo-N-(cyclohexylmethylideneamino)-1,3-dimethylpyrazole-5-carboxamide |
| SMILES | Cc1nn(C)c(C(=O)NN=CC2CCCCC2)c1Br |
| InChI | InChI=1S/C13H19BrN4O/c1-9-11(14)12(18(2)17-9)13(19)16-15-8-10-6-4-3-5-7-10/h8,10H,3-7H2,1-2H3,(H,16,19) |
| InChIKey | SUCJIFQIQHDALT-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.23 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|