C12H12BrN5O — CID 6873360
4-bromo-1,3-dimethyl-N-[(E)-pyridin-3-ylmethylideneamino]pyrazole-5-carboxamide (PubChem CID 6873360) has the molecular formula C12H12BrN5O and a molecular weight of 322.17 g/mol. Its IUPAC name is 4-bromo-1,3-dimethyl-N-[(E)-pyridin-3-ylmethylideneamino]pyrazole-5-carboxamide.
| Compound Name | 4-bromo-1,3-dimethyl-N-[(E)-pyridin-3-ylmethylideneamino]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 6873360 |
| Molecular Formula | C12H12BrN5O |
| Molecular Weight | 322.17 g/mol |
| Exact Mass | 321.02 |
| IUPAC Name | 4-bromo-1,3-dimethyl-N-[(E)-pyridin-3-ylmethylideneamino]pyrazole-5-carboxamide |
| SMILES | Cc1nn(C)c(C(=O)N/N=C/c2cccnc2)c1Br |
| InChI | InChI=1S/C12H12BrN5O/c1-8-10(13)11(18(2)17-8)12(19)16-15-7-9-4-3-5-14-6-9/h3-7H,1-2H3,(H,16,19)/b15-7+ |
| InChIKey | FWXLPGBOIPPQES-VIZOYTHASA-N |
| XLogP | 1.65 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.17 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|