C15H12BrN5O — CID 126018157
6-bromo-2-methyl-N-[(Z)-pyridin-3-ylmethylideneamino]imidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 126018157) has the molecular formula C15H12BrN5O and a molecular weight of 358.20 g/mol. Its IUPAC name is 6-bromo-2-methyl-N-[(Z)-pyridin-3-ylmethylideneamino]imidazo[1,2-a]pyridine-3-carboxamide.
| Compound Name | 6-bromo-2-methyl-N-[(Z)-pyridin-3-ylmethylideneamino]imidazo[1,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 126018157 |
| Molecular Formula | C15H12BrN5O |
| Molecular Weight | 358.20 g/mol |
| Exact Mass | 357.02 |
| IUPAC Name | 6-bromo-2-methyl-N-[(Z)-pyridin-3-ylmethylideneamino]imidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | Cc1nc2ccc(Br)cn2c1C(=O)N/N=C\c1cccnc1 |
| InChI | InChI=1S/C15H12BrN5O/c1-10-14(21-9-12(16)4-5-13(21)19-10)15(22)20-18-8-11-3-2-6-17-7-11/h2-9H,1H3,(H,20,22)/b18-8- |
| InChIKey | GWLMHKGMTRMTAN-LSCVHKIXSA-N |
| XLogP | 2.56 |
| TPSA | 71.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.20 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|