C18H18BrN5O — CID 171988440
6-bromo-N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-2-methylimidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 171988440) has the molecular formula C18H18BrN5O and a molecular weight of 400.28 g/mol. Its IUPAC name is 6-bromo-N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-2-methylimidazo[1,2-a]pyridine-3-carboxamide.
| Compound Name | 6-bromo-N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-2-methylimidazo[1,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 171988440 |
| Molecular Formula | C18H18BrN5O |
| Molecular Weight | 400.28 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | 6-bromo-N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-2-methylimidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | Cc1nc2ccc(Br)cn2c1C(=O)N/N=C/c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C18H18BrN5O/c1-12-17(24-11-14(19)6-9-16(24)21-12)18(25)22-20-10-13-4-7-15(8-5-13)23(2)3/h4-11H,1-3H3,(H,22,25)/b20-10+ |
| InChIKey | BFSPTUCEMXSSPY-KEBDBYFISA-N |
| XLogP | 3.24 |
| TPSA | 62.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.28 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|