C16H12BrFN4O — CID 5497455
6-bromo-N-[(Z)-(4-fluorophenyl)methylideneamino]-2-methylimidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 5497455) has the molecular formula C16H12BrFN4O and a molecular weight of 375.20 g/mol. Its IUPAC name is 6-bromo-N-[(Z)-(4-fluorophenyl)methylideneamino]-2-methylimidazo[1,2-a]pyridine-3-carboxamide.
| Compound Name | 6-bromo-N-[(Z)-(4-fluorophenyl)methylideneamino]-2-methylimidazo[1,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 5497455 |
| Molecular Formula | C16H12BrFN4O |
| Molecular Weight | 375.20 g/mol |
| Exact Mass | 374.02 |
| IUPAC Name | 6-bromo-N-[(Z)-(4-fluorophenyl)methylideneamino]-2-methylimidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | Cc1nc2ccc(Br)cn2c1C(=O)N/N=C\c1ccc(F)cc1 |
| InChI | InChI=1S/C16H12BrFN4O/c1-10-15(22-9-12(17)4-7-14(22)20-10)16(23)21-19-8-11-2-5-13(18)6-3-11/h2-9H,1H3,(H,21,23)/b19-8- |
| InChIKey | OTAVLTNBGZUYHW-UWVJOHFNSA-N |
| XLogP | 3.31 |
| TPSA | 58.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.20 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|