C15H17N3O3 — CID 4774461
2-[[3,5-dimethyl-1-[(2-methylphenyl)methyl]pyrazol-4-yl]amino]-2-oxoacetic acid (PubChem CID 4774461) has the molecular formula C15H17N3O3 and a molecular weight of 287.32 g/mol. Its IUPAC name is 2-[[3,5-dimethyl-1-[(2-methylphenyl)methyl]pyrazol-4-yl]amino]-2-oxoacetic acid.
| Compound Name | 2-[[3,5-dimethyl-1-[(2-methylphenyl)methyl]pyrazol-4-yl]amino]-2-oxoacetic acid |
|---|---|
| PubChem CID | 4774461 |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 2-[[3,5-dimethyl-1-[(2-methylphenyl)methyl]pyrazol-4-yl]amino]-2-oxoacetic acid |
| SMILES | Cc1ccccc1Cn1nc(C)c(NC(=O)C(=O)O)c1C |
| InChI | InChI=1S/C15H17N3O3/c1-9-6-4-5-7-12(9)8-18-11(3)13(10(2)17-18)16-14(19)15(20)21/h4-7H,8H2,1-3H3,(H,16,19)(H,20,21) |
| InChIKey | JTQOCHJRATXNQW-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|