C18H27N5S — CID 4777453
1-(tert-butylamino)-3-[3,5-dimethyl-1-[(2-methylphenyl)methyl]pyrazol-4-yl]thiourea (PubChem CID 4777453) has the molecular formula C18H27N5S and a molecular weight of 345.52 g/mol. Its IUPAC name is 1-(tert-butylamino)-3-[3,5-dimethyl-1-[(2-methylphenyl)methyl]pyrazol-4-yl]thiourea.
| Compound Name | 1-(tert-butylamino)-3-[3,5-dimethyl-1-[(2-methylphenyl)methyl]pyrazol-4-yl]thiourea |
|---|---|
| PubChem CID | 4777453 |
| Molecular Formula | C18H27N5S |
| Molecular Weight | 345.52 g/mol |
| Exact Mass | 345.20 |
| IUPAC Name | 1-(tert-butylamino)-3-[3,5-dimethyl-1-[(2-methylphenyl)methyl]pyrazol-4-yl]thiourea |
| SMILES | Cc1ccccc1Cn1nc(C)c(NC(=S)NNC(C)(C)C)c1C |
| InChI | InChI=1S/C18H27N5S/c1-12-9-7-8-10-15(12)11-23-14(3)16(13(2)21-23)19-17(24)20-22-18(4,5)6/h7-10,22H,11H2,1-6H3,(H2,19,20,24) |
| InChIKey | QHHITXOMFSGTND-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 53.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.52 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|