C19H22N4S2 — CID 19583484
1-[3,5-dimethyl-1-[(2-methylphenyl)methyl]pyrazol-4-yl]-3-(thiophen-2-ylmethyl)thiourea (PubChem CID 19583484) has the molecular formula C19H22N4S2 and a molecular weight of 370.55 g/mol. Its IUPAC name is 1-[3,5-dimethyl-1-[(2-methylphenyl)methyl]pyrazol-4-yl]-3-(thiophen-2-ylmethyl)thiourea.
| Compound Name | 1-[3,5-dimethyl-1-[(2-methylphenyl)methyl]pyrazol-4-yl]-3-(thiophen-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 19583484 |
| Molecular Formula | C19H22N4S2 |
| Molecular Weight | 370.55 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 1-[3,5-dimethyl-1-[(2-methylphenyl)methyl]pyrazol-4-yl]-3-(thiophen-2-ylmethyl)thiourea |
| SMILES | Cc1ccccc1Cn1nc(C)c(NC(=S)NCc2cccs2)c1C |
| InChI | InChI=1S/C19H22N4S2/c1-13-7-4-5-8-16(13)12-23-15(3)18(14(2)22-23)21-19(24)20-11-17-9-6-10-25-17/h4-10H,11-12H2,1-3H3,(H2,20,21,24) |
| InChIKey | ZMOIYAFMDDNBEW-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.55 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|