C12H17N7OS — CID 4774937
1-(1,3-dimethylpyrazol-4-yl)-3-[[2-(3-methylpyrazol-1-yl)acetyl]amino]thiourea (PubChem CID 4774937) has the molecular formula C12H17N7OS and a molecular weight of 307.38 g/mol. Its IUPAC name is 1-(1,3-dimethylpyrazol-4-yl)-3-[[2-(3-methylpyrazol-1-yl)acetyl]amino]thiourea.
| Compound Name | 1-(1,3-dimethylpyrazol-4-yl)-3-[[2-(3-methylpyrazol-1-yl)acetyl]amino]thiourea |
|---|---|
| PubChem CID | 4774937 |
| Molecular Formula | C12H17N7OS |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 1-(1,3-dimethylpyrazol-4-yl)-3-[[2-(3-methylpyrazol-1-yl)acetyl]amino]thiourea |
| SMILES | Cc1ccn(CC(=O)NNC(=S)Nc2cn(C)nc2C)n1 |
| InChI | InChI=1S/C12H17N7OS/c1-8-4-5-19(16-8)7-11(20)14-15-12(21)13-10-6-18(3)17-9(10)2/h4-6H,7H2,1-3H3,(H,14,20)(H2,13,15,21) |
| InChIKey | JWMATDRVGDYAEV-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 88.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|