C14H19F2N7OS — CID 4777138
1-[[2-[3-(difluoromethyl)-5-methylpyrazol-1-yl]acetyl]amino]-3-(1-ethyl-5-methylpyrazol-4-yl)thiourea (PubChem CID 4777138) has the molecular formula C14H19F2N7OS and a molecular weight of 371.42 g/mol. Its IUPAC name is 1-[[2-[3-(difluoromethyl)-5-methylpyrazol-1-yl]acetyl]amino]-3-(1-ethyl-5-methylpyrazol-4-yl)thiourea.
| Compound Name | 1-[[2-[3-(difluoromethyl)-5-methylpyrazol-1-yl]acetyl]amino]-3-(1-ethyl-5-methylpyrazol-4-yl)thiourea |
|---|---|
| PubChem CID | 4777138 |
| Molecular Formula | C14H19F2N7OS |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | 1-[[2-[3-(difluoromethyl)-5-methylpyrazol-1-yl]acetyl]amino]-3-(1-ethyl-5-methylpyrazol-4-yl)thiourea |
| SMILES | CCn1ncc(NC(=S)NNC(=O)Cn2nc(C(F)F)cc2C)c1C |
| InChI | InChI=1S/C14H19F2N7OS/c1-4-22-9(3)11(6-17-22)18-14(25)20-19-12(24)7-23-8(2)5-10(21-23)13(15)16/h5-6,13H,4,7H2,1-3H3,(H,19,24)(H2,18,20,25) |
| InChIKey | IAZZUJGBPMAEPG-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 88.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|