C13H18ClN7OS — CID 4777126
1-[3-(4-chloropyrazol-1-yl)propanoylamino]-3-(1-ethyl-5-methylpyrazol-4-yl)thiourea (PubChem CID 4777126) has the molecular formula C13H18ClN7OS and a molecular weight of 355.86 g/mol. Its IUPAC name is 1-[3-(4-chloropyrazol-1-yl)propanoylamino]-3-(1-ethyl-5-methylpyrazol-4-yl)thiourea.
| Compound Name | 1-[3-(4-chloropyrazol-1-yl)propanoylamino]-3-(1-ethyl-5-methylpyrazol-4-yl)thiourea |
|---|---|
| PubChem CID | 4777126 |
| Molecular Formula | C13H18ClN7OS |
| Molecular Weight | 355.86 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | 1-[3-(4-chloropyrazol-1-yl)propanoylamino]-3-(1-ethyl-5-methylpyrazol-4-yl)thiourea |
| SMILES | CCn1ncc(NC(=S)NNC(=O)CCn2cc(Cl)cn2)c1C |
| InChI | InChI=1S/C13H18ClN7OS/c1-3-21-9(2)11(7-16-21)17-13(23)19-18-12(22)4-5-20-8-10(14)6-15-20/h6-8H,3-5H2,1-2H3,(H,18,22)(H2,17,19,23) |
| InChIKey | HVMUFAVLVBXWDY-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 88.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.86 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|