C14H20ClN7OS — CID 4777007
1-[[2-(4-chloro-3,5-dimethylpyrazol-1-yl)acetyl]amino]-3-(1-ethyl-5-methylpyrazol-4-yl)thiourea (PubChem CID 4777007) has the molecular formula C14H20ClN7OS and a molecular weight of 369.88 g/mol. Its IUPAC name is 1-[[2-(4-chloro-3,5-dimethylpyrazol-1-yl)acetyl]amino]-3-(1-ethyl-5-methylpyrazol-4-yl)thiourea.
| Compound Name | 1-[[2-(4-chloro-3,5-dimethylpyrazol-1-yl)acetyl]amino]-3-(1-ethyl-5-methylpyrazol-4-yl)thiourea |
|---|---|
| PubChem CID | 4777007 |
| Molecular Formula | C14H20ClN7OS |
| Molecular Weight | 369.88 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | 1-[[2-(4-chloro-3,5-dimethylpyrazol-1-yl)acetyl]amino]-3-(1-ethyl-5-methylpyrazol-4-yl)thiourea |
| SMILES | CCn1ncc(NC(=S)NNC(=O)Cn2nc(C)c(Cl)c2C)c1C |
| InChI | InChI=1S/C14H20ClN7OS/c1-5-21-9(3)11(6-16-21)17-14(24)19-18-12(23)7-22-10(4)13(15)8(2)20-22/h6H,5,7H2,1-4H3,(H,18,23)(H2,17,19,24) |
| InChIKey | MVYZCIDUFYKOFA-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 88.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.88 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|