C19H30N4O3 — CID 47750330
N-[3-[[[2-(tert-butylamino)-2-oxoethyl]-methylcarbamoyl]amino]-2-methylphenyl]butanamide (PubChem CID 47750330) has the molecular formula C19H30N4O3 and a molecular weight of 362.47 g/mol. Its IUPAC name is N-[3-[[[2-(tert-butylamino)-2-oxoethyl]-methylcarbamoyl]amino]-2-methylphenyl]butanamide.
| Compound Name | N-[3-[[[2-(tert-butylamino)-2-oxoethyl]-methylcarbamoyl]amino]-2-methylphenyl]butanamide |
|---|---|
| PubChem CID | 47750330 |
| Molecular Formula | C19H30N4O3 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.23 |
| IUPAC Name | N-[3-[[[2-(tert-butylamino)-2-oxoethyl]-methylcarbamoyl]amino]-2-methylphenyl]butanamide |
| SMILES | CCCC(=O)Nc1cccc(NC(=O)N(C)CC(=O)NC(C)(C)C)c1C |
| InChI | InChI=1S/C19H30N4O3/c1-7-9-16(24)20-14-10-8-11-15(13(14)2)21-18(26)23(6)12-17(25)22-19(3,4)5/h8,10-11H,7,9,12H2,1-6H3,(H,20,24)(H,21,26)(H,22,25) |
| InChIKey | MFNFDCDHIDZNRF-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |