C16H19F2NO2 — CID 4775984
3-(azepan-1-yl)-1-[4-(difluoromethoxy)phenyl]prop-2-en-1-one (PubChem CID 4775984) has the molecular formula C16H19F2NO2 and a molecular weight of 295.33 g/mol. Its IUPAC name is 3-(azepan-1-yl)-1-[4-(difluoromethoxy)phenyl]prop-2-en-1-one.
| Compound Name | 3-(azepan-1-yl)-1-[4-(difluoromethoxy)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 4775984 |
| Molecular Formula | C16H19F2NO2 |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 3-(azepan-1-yl)-1-[4-(difluoromethoxy)phenyl]prop-2-en-1-one |
| SMILES | O=C(C=CN1CCCCCC1)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C16H19F2NO2/c17-16(18)21-14-7-5-13(6-8-14)15(20)9-12-19-10-3-1-2-4-11-19/h5-9,12,16H,1-4,10-11H2 |
| InChIKey | DTPUFNLEHIHJBO-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|