C21H20Cl2F2N2O2 — CID 4866522
3-[4-[(2,4-dichlorophenyl)methyl]piperazin-1-yl]-1-[4-(difluoromethoxy)phenyl]prop-2-en-1-one (PubChem CID 4866522) has the molecular formula C21H20Cl2F2N2O2 and a molecular weight of 441.31 g/mol. Its IUPAC name is 3-[4-[(2,4-dichlorophenyl)methyl]piperazin-1-yl]-1-[4-(difluoromethoxy)phenyl]prop-2-en-1-one.
| Compound Name | 3-[4-[(2,4-dichlorophenyl)methyl]piperazin-1-yl]-1-[4-(difluoromethoxy)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 4866522 |
| Molecular Formula | C21H20Cl2F2N2O2 |
| Molecular Weight | 441.31 g/mol |
| Exact Mass | 440.09 |
| IUPAC Name | 3-[4-[(2,4-dichlorophenyl)methyl]piperazin-1-yl]-1-[4-(difluoromethoxy)phenyl]prop-2-en-1-one |
| SMILES | O=C(C=CN1CCN(Cc2ccc(Cl)cc2Cl)CC1)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C21H20Cl2F2N2O2/c22-17-4-1-16(19(23)13-17)14-27-11-9-26(10-12-27)8-7-20(28)15-2-5-18(6-3-15)29-21(24)25/h1-8,13,21H,9-12,14H2 |
| InChIKey | DWKVQCMBWKZEIQ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.31 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|