C17H12F3N3O4 — CID 47771929
3-benzyl-5-[[4-nitro-2-(trifluoromethyl)phenoxy]methyl]-1,2,4-oxadiazole (PubChem CID 47771929) has the molecular formula C17H12F3N3O4 and a molecular weight of 379.29 g/mol. Its IUPAC name is 3-benzyl-5-[[4-nitro-2-(trifluoromethyl)phenoxy]methyl]-1,2,4-oxadiazole.
| Compound Name | 3-benzyl-5-[[4-nitro-2-(trifluoromethyl)phenoxy]methyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 47771929 |
| Molecular Formula | C17H12F3N3O4 |
| Molecular Weight | 379.29 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | 3-benzyl-5-[[4-nitro-2-(trifluoromethyl)phenoxy]methyl]-1,2,4-oxadiazole |
| SMILES | O=[N+]([O-])c1ccc(OCc2nc(Cc3ccccc3)no2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H12F3N3O4/c18-17(19,20)13-9-12(23(24)25)6-7-14(13)26-10-16-21-15(22-27-16)8-11-4-2-1-3-5-11/h1-7,9H,8,10H2 |
| InChIKey | QYLMNCIJSMKLCR-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 91.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.29 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|