C16H11F6NO3 — CID 175518362
4-nitro-2-(trifluoromethyl)-1-(1,1,1-trifluoro-3-phenylpropan-2-yl)oxybenzene (PubChem CID 175518362) has the molecular formula C16H11F6NO3 and a molecular weight of 379.26 g/mol. Its IUPAC name is 4-nitro-2-(trifluoromethyl)-1-(1,1,1-trifluoro-3-phenylpropan-2-yl)oxybenzene.
| Compound Name | 4-nitro-2-(trifluoromethyl)-1-(1,1,1-trifluoro-3-phenylpropan-2-yl)oxybenzene |
|---|---|
| PubChem CID | 175518362 |
| Molecular Formula | C16H11F6NO3 |
| Molecular Weight | 379.26 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | 4-nitro-2-(trifluoromethyl)-1-(1,1,1-trifluoro-3-phenylpropan-2-yl)oxybenzene |
| SMILES | O=[N+]([O-])c1ccc(OC(Cc2ccccc2)C(F)(F)F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H11F6NO3/c17-15(18,19)12-9-11(23(24)25)6-7-13(12)26-14(16(20,21)22)8-10-4-2-1-3-5-10/h1-7,9,14H,8H2 |
| InChIKey | QDTBCVYRNYDRMM-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.26 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|