About 2-amino-N,N-dimethylbenzamide
2-amino-N,N-dimethylbenzamide (PubChem CID 4778175) has the molecular formula C9H12N2O
and a molecular weight of 164.21 g/mol. Its IUPAC name is 2-amino-N,N-dimethylbenzamide.
Molecular Properties
| Compound Name | 2-amino-N,N-dimethylbenzamide |
| PubChem CID | 4778175 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | 2-amino-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccccc1N |
| InChI | InChI=1S/C9H12N2O/c1-11(2)9(12)7-5-3-4-6-8(7)10/h3-6H,10H2,1-2H3 |
| InChIKey | DPXIIVXPZPOINE-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-N,N-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N,N-dimethylbenzamide?
The IUPAC name of 2-amino-N,N-dimethylbenzamide (CID 4778175) is 2-amino-N,N-dimethylbenzamide.
What is the SMILES notation for 2-amino-N,N-dimethylbenzamide?
The canonical SMILES for 2-amino-N,N-dimethylbenzamide is CN(C)C(=O)c1ccccc1N.
What is the InChIKey of 2-amino-N,N-dimethylbenzamide?
The InChIKey is DPXIIVXPZPOINE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O/c1-11(2)9(12)7-5-3-4-6-8(7)10/h3-6H,10H2,1-2H3.
What are the key properties of 2-amino-N,N-dimethylbenzamide?
2-amino-N,N-dimethylbenzamide has a molecular weight of 164.21 g/mol, XLogP of 0.97, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N,N-dimethylbenzamide is sourced from PubChem (CID 4778175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).