C15H16FNO6S2 — CID 47784339
N-[4-fluoro-2-(2-hydroxyethoxy)phenyl]-4-methylsulfonylbenzenesulfonamide (PubChem CID 47784339) has the molecular formula C15H16FNO6S2 and a molecular weight of 389.43 g/mol. Its IUPAC name is N-[4-fluoro-2-(2-hydroxyethoxy)phenyl]-4-methylsulfonylbenzenesulfonamide.
| Compound Name | N-[4-fluoro-2-(2-hydroxyethoxy)phenyl]-4-methylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 47784339 |
| Molecular Formula | C15H16FNO6S2 |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.04 |
| IUPAC Name | N-[4-fluoro-2-(2-hydroxyethoxy)phenyl]-4-methylsulfonylbenzenesulfonamide |
| SMILES | CS(=O)(=O)c1ccc(S(=O)(=O)Nc2ccc(F)cc2OCCO)cc1 |
| InChI | InChI=1S/C15H16FNO6S2/c1-24(19,20)12-3-5-13(6-4-12)25(21,22)17-14-7-2-11(16)10-15(14)23-9-8-18/h2-7,10,17-18H,8-9H2,1H3 |
| InChIKey | LSAMBRLGLZEQHY-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |