C19H25N5O5 — CID 47797811
5-(diethylaminomethyl)-N'-[2-(dimethylamino)-5-nitrobenzoyl]furan-2-carbohydrazide (PubChem CID 47797811) has the molecular formula C19H25N5O5 and a molecular weight of 403.44 g/mol. Its IUPAC name is 5-(diethylaminomethyl)-N'-[2-(dimethylamino)-5-nitrobenzoyl]furan-2-carbohydrazide.
| Compound Name | 5-(diethylaminomethyl)-N'-[2-(dimethylamino)-5-nitrobenzoyl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 47797811 |
| Molecular Formula | C19H25N5O5 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | 5-(diethylaminomethyl)-N'-[2-(dimethylamino)-5-nitrobenzoyl]furan-2-carbohydrazide |
| SMILES | CCN(CC)Cc1ccc(C(=O)NNC(=O)c2cc([N+](=O)[O-])ccc2N(C)C)o1 |
| InChI | InChI=1S/C19H25N5O5/c1-5-23(6-2)12-14-8-10-17(29-14)19(26)21-20-18(25)15-11-13(24(27)28)7-9-16(15)22(3)4/h7-11H,5-6,12H2,1-4H3,(H,20,25)(H,21,26) |
| InChIKey | SSZJFOAHRGCBGN-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 120.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|