C24H31N3O4 — CID 4779860
[2-oxo-2-[3-(2-oxopyrrolidin-1-yl)propylamino]ethyl] 3-ethyl-2-propylquinoline-4-carboxylate (PubChem CID 4779860) has the molecular formula C24H31N3O4 and a molecular weight of 425.53 g/mol. Its IUPAC name is [2-oxo-2-[3-(2-oxopyrrolidin-1-yl)propylamino]ethyl] 3-ethyl-2-propylquinoline-4-carboxylate.
| Compound Name | [2-oxo-2-[3-(2-oxopyrrolidin-1-yl)propylamino]ethyl] 3-ethyl-2-propylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 4779860 |
| Molecular Formula | C24H31N3O4 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | [2-oxo-2-[3-(2-oxopyrrolidin-1-yl)propylamino]ethyl] 3-ethyl-2-propylquinoline-4-carboxylate |
| SMILES | CCCc1nc2ccccc2c(C(=O)OCC(=O)NCCCN2CCCC2=O)c1CC |
| InChI | InChI=1S/C24H31N3O4/c1-3-9-19-17(4-2)23(18-10-5-6-11-20(18)26-19)24(30)31-16-21(28)25-13-8-15-27-14-7-12-22(27)29/h5-6,10-11H,3-4,7-9,12-16H2,1-2H3,(H,25,28) |
| InChIKey | UUJHJSUWEYCYOV-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|