C16H17F3N2O2S2 — CID 47803095
4,4,4-trifluoro-3-hydroxy-1-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-3-(4-methyl-1,3-thiazol-2-yl)butan-1-one (PubChem CID 47803095) has the molecular formula C16H17F3N2O2S2 and a molecular weight of 390.45 g/mol. Its IUPAC name is 4,4,4-trifluoro-3-hydroxy-1-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-3-(4-methyl-1,3-thiazol-2-yl)butan-1-one.
| Compound Name | 4,4,4-trifluoro-3-hydroxy-1-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-3-(4-methyl-1,3-thiazol-2-yl)butan-1-one |
|---|---|
| PubChem CID | 47803095 |
| Molecular Formula | C16H17F3N2O2S2 |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | 4,4,4-trifluoro-3-hydroxy-1-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-3-(4-methyl-1,3-thiazol-2-yl)butan-1-one |
| SMILES | Cc1csc(C(O)(CC(=O)N2CCc3sccc3C2C)C(F)(F)F)n1 |
| InChI | InChI=1S/C16H17F3N2O2S2/c1-9-8-25-14(20-9)15(23,16(17,18)19)7-13(22)21-5-3-12-11(10(21)2)4-6-24-12/h4,6,8,10,23H,3,5,7H2,1-2H3 |
| InChIKey | LPZKTGBUGCFXMI-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |