C21H20F3N3O2S — CID 95148037
(3R)-4,4,4-trifluoro-3-hydroxy-3-(4-methyl-1,3-thiazol-2-yl)-1-[(1S)-1-phenyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]butan-1-one (PubChem CID 95148037) has the molecular formula C21H20F3N3O2S and a molecular weight of 435.47 g/mol. Its IUPAC name is (3R)-4,4,4-trifluoro-3-hydroxy-3-(4-methyl-1,3-thiazol-2-yl)-1-[(1S)-1-phenyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]butan-1-one.
| Compound Name | (3R)-4,4,4-trifluoro-3-hydroxy-3-(4-methyl-1,3-thiazol-2-yl)-1-[(1S)-1-phenyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]butan-1-one |
|---|---|
| PubChem CID | 95148037 |
| Molecular Formula | C21H20F3N3O2S |
| Molecular Weight | 435.47 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | (3R)-4,4,4-trifluoro-3-hydroxy-3-(4-methyl-1,3-thiazol-2-yl)-1-[(1S)-1-phenyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]butan-1-one |
| SMILES | Cc1csc([C@@](O)(CC(=O)N2CCn3cccc3[C@@H]2c2ccccc2)C(F)(F)F)n1 |
| InChI | InChI=1S/C21H20F3N3O2S/c1-14-13-30-19(25-14)20(29,21(22,23)24)12-17(28)27-11-10-26-9-5-8-16(26)18(27)15-6-3-2-4-7-15/h2-9,13,18,29H,10-12H2,1H3/t18-,20-/m0/s1 |
| InChIKey | IFXXMAYPNBRAIP-ICSRJNTNSA-N |
| XLogP | 4.02 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.47 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |