C22H17FN6O3S — CID 4780526
N-[2-(4-fluoroanilino)-5-nitrophenyl]-2-[(4-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetamide (PubChem CID 4780526) has the molecular formula C22H17FN6O3S and a molecular weight of 464.48 g/mol. Its IUPAC name is N-[2-(4-fluoroanilino)-5-nitrophenyl]-2-[(4-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetamide.
| Compound Name | N-[2-(4-fluoroanilino)-5-nitrophenyl]-2-[(4-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 4780526 |
| Molecular Formula | C22H17FN6O3S |
| Molecular Weight | 464.48 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | N-[2-(4-fluoroanilino)-5-nitrophenyl]-2-[(4-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
| SMILES | O=C(CSc1nncn1-c1ccccc1)Nc1cc([N+](=O)[O-])ccc1Nc1ccc(F)cc1 |
| InChI | InChI=1S/C22H17FN6O3S/c23-15-6-8-16(9-7-15)25-19-11-10-18(29(31)32)12-20(19)26-21(30)13-33-22-27-24-14-28(22)17-4-2-1-3-5-17/h1-12,14,25H,13H2,(H,26,30) |
| InChIKey | ZMMNHTYHCBTBFT-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 114.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.48 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|