C17H16N2O4S2 — CID 4780812
3-(methylsulfanylmethyl)-N-(3-sulfamoylphenyl)-1-benzofuran-2-carboxamide (PubChem CID 4780812) has the molecular formula C17H16N2O4S2 and a molecular weight of 376.46 g/mol. Its IUPAC name is 3-(methylsulfanylmethyl)-N-(3-sulfamoylphenyl)-1-benzofuran-2-carboxamide.
| Compound Name | 3-(methylsulfanylmethyl)-N-(3-sulfamoylphenyl)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 4780812 |
| Molecular Formula | C17H16N2O4S2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | 3-(methylsulfanylmethyl)-N-(3-sulfamoylphenyl)-1-benzofuran-2-carboxamide |
| SMILES | CSCc1c(C(=O)Nc2cccc(S(N)(=O)=O)c2)oc2ccccc12 |
| InChI | InChI=1S/C17H16N2O4S2/c1-24-10-14-13-7-2-3-8-15(13)23-16(14)17(20)19-11-5-4-6-12(9-11)25(18,21)22/h2-9H,10H2,1H3,(H,19,20)(H2,18,21,22) |
| InChIKey | YPWHNBJAKMFGEM-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 102.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |