C18H16BrNO2S — CID 26731468
N-(4-bromo-2-methylphenyl)-3-(methylsulfanylmethyl)-1-benzofuran-2-carboxamide (PubChem CID 26731468) has the molecular formula C18H16BrNO2S and a molecular weight of 390.30 g/mol. Its IUPAC name is N-(4-bromo-2-methylphenyl)-3-(methylsulfanylmethyl)-1-benzofuran-2-carboxamide.
| Compound Name | N-(4-bromo-2-methylphenyl)-3-(methylsulfanylmethyl)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 26731468 |
| Molecular Formula | C18H16BrNO2S |
| Molecular Weight | 390.30 g/mol |
| Exact Mass | 389.01 |
| IUPAC Name | N-(4-bromo-2-methylphenyl)-3-(methylsulfanylmethyl)-1-benzofuran-2-carboxamide |
| SMILES | CSCc1c(C(=O)Nc2ccc(Br)cc2C)oc2ccccc12 |
| InChI | InChI=1S/C18H16BrNO2S/c1-11-9-12(19)7-8-15(11)20-18(21)17-14(10-23-2)13-5-3-4-6-16(13)22-17/h3-9H,10H2,1-2H3,(H,20,21) |
| InChIKey | HLQGZUJXCOHWNM-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.30 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |