C23H32N2O4 — CID 47810477
4-[[2-[(2,6-dimethylmorpholin-4-yl)methyl]pyrrolidin-1-yl]methyl]-6-ethyl-7-hydroxychromen-2-one (PubChem CID 47810477) has the molecular formula C23H32N2O4 and a molecular weight of 400.52 g/mol. Its IUPAC name is 4-[[2-[(2,6-dimethylmorpholin-4-yl)methyl]pyrrolidin-1-yl]methyl]-6-ethyl-7-hydroxychromen-2-one.
| Compound Name | 4-[[2-[(2,6-dimethylmorpholin-4-yl)methyl]pyrrolidin-1-yl]methyl]-6-ethyl-7-hydroxychromen-2-one |
|---|---|
| PubChem CID | 47810477 |
| Molecular Formula | C23H32N2O4 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | 4-[[2-[(2,6-dimethylmorpholin-4-yl)methyl]pyrrolidin-1-yl]methyl]-6-ethyl-7-hydroxychromen-2-one |
| SMILES | CCc1cc2c(CN3CCCC3CN3CC(C)OC(C)C3)cc(=O)oc2cc1O |
| InChI | InChI=1S/C23H32N2O4/c1-4-17-8-20-18(9-23(27)29-22(20)10-21(17)26)13-25-7-5-6-19(25)14-24-11-15(2)28-16(3)12-24/h8-10,15-16,19,26H,4-7,11-14H2,1-3H3 |
| InChIKey | MOEKVLVZBGZSFO-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|