C16H27N3O4S2 — CID 47812603
N-[2-(4-methylsulfonylpiperazin-1-yl)ethyl]-4-propylbenzenesulfonamide (PubChem CID 47812603) has the molecular formula C16H27N3O4S2 and a molecular weight of 389.54 g/mol. Its IUPAC name is N-[2-(4-methylsulfonylpiperazin-1-yl)ethyl]-4-propylbenzenesulfonamide.
| Compound Name | N-[2-(4-methylsulfonylpiperazin-1-yl)ethyl]-4-propylbenzenesulfonamide |
|---|---|
| PubChem CID | 47812603 |
| Molecular Formula | C16H27N3O4S2 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | N-[2-(4-methylsulfonylpiperazin-1-yl)ethyl]-4-propylbenzenesulfonamide |
| SMILES | CCCc1ccc(S(=O)(=O)NCCN2CCN(S(C)(=O)=O)CC2)cc1 |
| InChI | InChI=1S/C16H27N3O4S2/c1-3-4-15-5-7-16(8-6-15)25(22,23)17-9-10-18-11-13-19(14-12-18)24(2,20)21/h5-8,17H,3-4,9-14H2,1-2H3 |
| InChIKey | XGFLKFDOIVTYEK-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |