C22H31N3O2S — CID 47029544
N-[[2-[(4-methylpiperazin-1-yl)methyl]phenyl]methyl]-4-propylbenzenesulfonamide (PubChem CID 47029544) has the molecular formula C22H31N3O2S and a molecular weight of 401.58 g/mol. Its IUPAC name is N-[[2-[(4-methylpiperazin-1-yl)methyl]phenyl]methyl]-4-propylbenzenesulfonamide.
| Compound Name | N-[[2-[(4-methylpiperazin-1-yl)methyl]phenyl]methyl]-4-propylbenzenesulfonamide |
|---|---|
| PubChem CID | 47029544 |
| Molecular Formula | C22H31N3O2S |
| Molecular Weight | 401.58 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | N-[[2-[(4-methylpiperazin-1-yl)methyl]phenyl]methyl]-4-propylbenzenesulfonamide |
| SMILES | CCCc1ccc(S(=O)(=O)NCc2ccccc2CN2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C22H31N3O2S/c1-3-6-19-9-11-22(12-10-19)28(26,27)23-17-20-7-4-5-8-21(20)18-25-15-13-24(2)14-16-25/h4-5,7-12,23H,3,6,13-18H2,1-2H3 |
| InChIKey | BDHXDYRDSGOROK-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.58 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |