C23H25N3O5 — CID 4790489
N-[1-(1,3-benzodioxol-5-yl)ethyl]-2-(2,5-dioxo-4-phenyl-4-propylimidazolidin-1-yl)acetamide (PubChem CID 4790489) has the molecular formula C23H25N3O5 and a molecular weight of 423.47 g/mol. Its IUPAC name is N-[1-(1,3-benzodioxol-5-yl)ethyl]-2-(2,5-dioxo-4-phenyl-4-propylimidazolidin-1-yl)acetamide.
| Compound Name | N-[1-(1,3-benzodioxol-5-yl)ethyl]-2-(2,5-dioxo-4-phenyl-4-propylimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 4790489 |
| Molecular Formula | C23H25N3O5 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | N-[1-(1,3-benzodioxol-5-yl)ethyl]-2-(2,5-dioxo-4-phenyl-4-propylimidazolidin-1-yl)acetamide |
| SMILES | CCCC1(c2ccccc2)NC(=O)N(CC(=O)NC(C)c2ccc3c(c2)OCO3)C1=O |
| InChI | InChI=1S/C23H25N3O5/c1-3-11-23(17-7-5-4-6-8-17)21(28)26(22(29)25-23)13-20(27)24-15(2)16-9-10-18-19(12-16)31-14-30-18/h4-10,12,15H,3,11,13-14H2,1-2H3,(H,24,27)(H,25,29) |
| InChIKey | BOKJRUCRFJYSFP-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|