C21H22FN3O2 — CID 4790762
N-[(4-fluorophenyl)methyl]-3-(3-methylbutyl)-4-oxophthalazine-1-carboxamide (PubChem CID 4790762) has the molecular formula C21H22FN3O2 and a molecular weight of 367.42 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-3-(3-methylbutyl)-4-oxophthalazine-1-carboxamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-3-(3-methylbutyl)-4-oxophthalazine-1-carboxamide |
|---|---|
| PubChem CID | 4790762 |
| Molecular Formula | C21H22FN3O2 |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-3-(3-methylbutyl)-4-oxophthalazine-1-carboxamide |
| SMILES | CC(C)CCn1nc(C(=O)NCc2ccc(F)cc2)c2ccccc2c1=O |
| InChI | InChI=1S/C21H22FN3O2/c1-14(2)11-12-25-21(27)18-6-4-3-5-17(18)19(24-25)20(26)23-13-15-7-9-16(22)10-8-15/h3-10,14H,11-13H2,1-2H3,(H,23,26) |
| InChIKey | QTKOKPBILUQABF-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |