C21H24N4O2S — CID 9152725
3-(3-methylbutyl)-N-[(Z)-1-(5-methylthiophen-2-yl)ethylideneamino]-4-oxophthalazine-1-carboxamide (PubChem CID 9152725) has the molecular formula C21H24N4O2S and a molecular weight of 396.52 g/mol. Its IUPAC name is 3-(3-methylbutyl)-N-[(Z)-1-(5-methylthiophen-2-yl)ethylideneamino]-4-oxophthalazine-1-carboxamide.
| Compound Name | 3-(3-methylbutyl)-N-[(Z)-1-(5-methylthiophen-2-yl)ethylideneamino]-4-oxophthalazine-1-carboxamide |
|---|---|
| PubChem CID | 9152725 |
| Molecular Formula | C21H24N4O2S |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | 3-(3-methylbutyl)-N-[(Z)-1-(5-methylthiophen-2-yl)ethylideneamino]-4-oxophthalazine-1-carboxamide |
| SMILES | C/C(=N/NC(=O)c1nn(CCC(C)C)c(=O)c2ccccc12)c1ccc(C)s1 |
| InChI | InChI=1S/C21H24N4O2S/c1-13(2)11-12-25-21(27)17-8-6-5-7-16(17)19(24-25)20(26)23-22-15(4)18-10-9-14(3)28-18/h5-10,13H,11-12H2,1-4H3,(H,23,26)/b22-15- |
| InChIKey | KYVLAGWTXGVHQX-JCMHNJIXSA-N |
| XLogP | 3.97 |
| TPSA | 76.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|