C15H19N3O4 — CID 4790928
2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-(furan-2-ylmethyl)-N-methylacetamide (PubChem CID 4790928) has the molecular formula C15H19N3O4 and a molecular weight of 305.33 g/mol. Its IUPAC name is 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-(furan-2-ylmethyl)-N-methylacetamide.
| Compound Name | 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-(furan-2-ylmethyl)-N-methylacetamide |
|---|---|
| PubChem CID | 4790928 |
| Molecular Formula | C15H19N3O4 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-(furan-2-ylmethyl)-N-methylacetamide |
| SMILES | CN(Cc1ccco1)C(=O)CN1C(=O)NC2(CCCC2)C1=O |
| InChI | InChI=1S/C15H19N3O4/c1-17(9-11-5-4-8-22-11)12(19)10-18-13(20)15(16-14(18)21)6-2-3-7-15/h4-5,8H,2-3,6-7,9-10H2,1H3,(H,16,21) |
| InChIKey | INZFJVIUPYKWQH-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|