C19H27ClN4O2 — CID 47927297
2-(4-chlorophenoxy)-N-[1-[2-(diethylamino)ethyl]pyrazol-4-yl]-2-methylpropanamide (PubChem CID 47927297) has the molecular formula C19H27ClN4O2 and a molecular weight of 378.90 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-[1-[2-(diethylamino)ethyl]pyrazol-4-yl]-2-methylpropanamide.
| Compound Name | 2-(4-chlorophenoxy)-N-[1-[2-(diethylamino)ethyl]pyrazol-4-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 47927297 |
| Molecular Formula | C19H27ClN4O2 |
| Molecular Weight | 378.90 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-[1-[2-(diethylamino)ethyl]pyrazol-4-yl]-2-methylpropanamide |
| SMILES | CCN(CC)CCn1cc(NC(=O)C(C)(C)Oc2ccc(Cl)cc2)cn1 |
| InChI | InChI=1S/C19H27ClN4O2/c1-5-23(6-2)11-12-24-14-16(13-21-24)22-18(25)19(3,4)26-17-9-7-15(20)8-10-17/h7-10,13-14H,5-6,11-12H2,1-4H3,(H,22,25) |
| InChIKey | ZLVLXWXDCDNGMQ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.90 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |