C19H22N4O3S2 — CID 4793397
N-(1,1-dioxothiolan-3-yl)-2-[(5,7,9-trimethyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]acetamide (PubChem CID 4793397) has the molecular formula C19H22N4O3S2 and a molecular weight of 418.54 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-2-[(5,7,9-trimethyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]acetamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-2-[(5,7,9-trimethyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 4793397 |
| Molecular Formula | C19H22N4O3S2 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-2-[(5,7,9-trimethyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]acetamide |
| SMILES | Cc1cc(C)c2c(c1)c(C)cc1nnc(SCC(=O)NC3CCS(=O)(=O)C3)n12 |
| InChI | InChI=1S/C19H22N4O3S2/c1-11-6-13(3)18-15(7-11)12(2)8-16-21-22-19(23(16)18)27-9-17(24)20-14-4-5-28(25,26)10-14/h6-8,14H,4-5,9-10H2,1-3H3,(H,20,24) |
| InChIKey | SXTVSVWEZLCUSZ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 93.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |