C16H13N3O2S — CID 4794329
5-(2-anilino-1,3-thiazol-4-yl)-2-hydroxybenzamide (PubChem CID 4794329) has the molecular formula C16H13N3O2S and a molecular weight of 311.37 g/mol. Its IUPAC name is 5-(2-anilino-1,3-thiazol-4-yl)-2-hydroxybenzamide.
| Compound Name | 5-(2-anilino-1,3-thiazol-4-yl)-2-hydroxybenzamide |
|---|---|
| PubChem CID | 4794329 |
| Molecular Formula | C16H13N3O2S |
| Molecular Weight | 311.37 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | 5-(2-anilino-1,3-thiazol-4-yl)-2-hydroxybenzamide |
| SMILES | NC(=O)c1cc(-c2csc(Nc3ccccc3)n2)ccc1O |
| InChI | InChI=1S/C16H13N3O2S/c17-15(21)12-8-10(6-7-14(12)20)13-9-22-16(19-13)18-11-4-2-1-3-5-11/h1-9,20H,(H2,17,21)(H,18,19) |
| InChIKey | HIFWZQNCMNKNNP-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.37 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |