C21H24N6O3S — CID 4797268
6-amino-1-benzyl-3-methyl-5-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)acetyl]pyrimidine-2,4-dione (PubChem CID 4797268) has the molecular formula C21H24N6O3S and a molecular weight of 440.53 g/mol. Its IUPAC name is 6-amino-1-benzyl-3-methyl-5-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)acetyl]pyrimidine-2,4-dione.
| Compound Name | 6-amino-1-benzyl-3-methyl-5-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)acetyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 4797268 |
| Molecular Formula | C21H24N6O3S |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | 6-amino-1-benzyl-3-methyl-5-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)acetyl]pyrimidine-2,4-dione |
| SMILES | Cn1c(=O)c(C(=O)CSc2nnc3n2CCCCC3)c(N)n(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C21H24N6O3S/c1-25-19(29)17(18(22)27(21(25)30)12-14-8-4-2-5-9-14)15(28)13-31-20-24-23-16-10-6-3-7-11-26(16)20/h2,4-5,8-9H,3,6-7,10-13,22H2,1H3 |
| InChIKey | IKQPIXGYXCXYPS-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 117.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |