C28H31N5O4S — CID 16534766
6-amino-1-benzyl-5-[2-(3-hexyl-4-oxoquinazolin-2-yl)sulfanylacetyl]-3-methylpyrimidine-2,4-dione (PubChem CID 16534766) has the molecular formula C28H31N5O4S and a molecular weight of 533.65 g/mol. Its IUPAC name is 6-amino-1-benzyl-5-[2-(3-hexyl-4-oxoquinazolin-2-yl)sulfanylacetyl]-3-methylpyrimidine-2,4-dione.
| Compound Name | 6-amino-1-benzyl-5-[2-(3-hexyl-4-oxoquinazolin-2-yl)sulfanylacetyl]-3-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 16534766 |
| Molecular Formula | C28H31N5O4S |
| Molecular Weight | 533.65 g/mol |
| Exact Mass | 533.21 |
| IUPAC Name | 6-amino-1-benzyl-5-[2-(3-hexyl-4-oxoquinazolin-2-yl)sulfanylacetyl]-3-methylpyrimidine-2,4-dione |
| SMILES | CCCCCCn1c(SCC(=O)c2c(N)n(Cc3ccccc3)c(=O)n(C)c2=O)nc2ccccc2c1=O |
| InChI | InChI=1S/C28H31N5O4S/c1-3-4-5-11-16-32-25(35)20-14-9-10-15-21(20)30-27(32)38-18-22(34)23-24(29)33(28(37)31(2)26(23)36)17-19-12-7-6-8-13-19/h6-10,12-15H,3-5,11,16-18,29H2,1-2H3 |
| InChIKey | YWNWLCQQBTZPJY-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 121.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.65 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|