C22H20N2O3S — CID 9329608
2-[2-(1-benzofuran-2-yl)-2-oxoethyl]sulfanyl-3-butylquinazolin-4-one (PubChem CID 9329608) has the molecular formula C22H20N2O3S and a molecular weight of 392.48 g/mol. Its IUPAC name is 2-[2-(1-benzofuran-2-yl)-2-oxoethyl]sulfanyl-3-butylquinazolin-4-one.
| Compound Name | 2-[2-(1-benzofuran-2-yl)-2-oxoethyl]sulfanyl-3-butylquinazolin-4-one |
|---|---|
| PubChem CID | 9329608 |
| Molecular Formula | C22H20N2O3S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | 2-[2-(1-benzofuran-2-yl)-2-oxoethyl]sulfanyl-3-butylquinazolin-4-one |
| SMILES | CCCCn1c(SCC(=O)c2cc3ccccc3o2)nc2ccccc2c1=O |
| InChI | InChI=1S/C22H20N2O3S/c1-2-3-12-24-21(26)16-9-5-6-10-17(16)23-22(24)28-14-18(25)20-13-15-8-4-7-11-19(15)27-20/h4-11,13H,2-3,12,14H2,1H3 |
| InChIKey | FPLWVLKXHBWKOM-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 65.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |