C18H24BrN3O3 — CID 4804609
N-(4-bromo-2-methylphenyl)-2-[4-methyl-4-(3-methylbutyl)-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 4804609) has the molecular formula C18H24BrN3O3 and a molecular weight of 410.31 g/mol. Its IUPAC name is N-(4-bromo-2-methylphenyl)-2-[4-methyl-4-(3-methylbutyl)-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-(4-bromo-2-methylphenyl)-2-[4-methyl-4-(3-methylbutyl)-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 4804609 |
| Molecular Formula | C18H24BrN3O3 |
| Molecular Weight | 410.31 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | N-(4-bromo-2-methylphenyl)-2-[4-methyl-4-(3-methylbutyl)-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | Cc1cc(Br)ccc1NC(=O)CN1C(=O)NC(C)(CCC(C)C)C1=O |
| InChI | InChI=1S/C18H24BrN3O3/c1-11(2)7-8-18(4)16(24)22(17(25)21-18)10-15(23)20-14-6-5-13(19)9-12(14)3/h5-6,9,11H,7-8,10H2,1-4H3,(H,20,23)(H,21,25) |
| InChIKey | WIIDBHSXGDCZAR-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.31 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|