C22H25N5O2S2 — CID 4804937
1-ethyl-N,N-dimethyl-2-[(1-prop-2-enylbenzimidazol-2-yl)sulfanylmethyl]benzimidazole-5-sulfonamide (PubChem CID 4804937) has the molecular formula C22H25N5O2S2 and a molecular weight of 455.61 g/mol. Its IUPAC name is 1-ethyl-N,N-dimethyl-2-[(1-prop-2-enylbenzimidazol-2-yl)sulfanylmethyl]benzimidazole-5-sulfonamide.
| Compound Name | 1-ethyl-N,N-dimethyl-2-[(1-prop-2-enylbenzimidazol-2-yl)sulfanylmethyl]benzimidazole-5-sulfonamide |
|---|---|
| PubChem CID | 4804937 |
| Molecular Formula | C22H25N5O2S2 |
| Molecular Weight | 455.61 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | 1-ethyl-N,N-dimethyl-2-[(1-prop-2-enylbenzimidazol-2-yl)sulfanylmethyl]benzimidazole-5-sulfonamide |
| SMILES | C=CCn1c(SCc2nc3cc(S(=O)(=O)N(C)C)ccc3n2CC)nc2ccccc21 |
| InChI | InChI=1S/C22H25N5O2S2/c1-5-13-27-19-10-8-7-9-17(19)24-22(27)30-15-21-23-18-14-16(31(28,29)25(3)4)11-12-20(18)26(21)6-2/h5,7-12,14H,1,6,13,15H2,2-4H3 |
| InChIKey | MEYFYFXDJFABGL-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 73.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.61 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|