C17H26N4O2S3 — CID 8818959
[5-(dimethylsulfamoyl)-1-ethylbenzimidazol-2-yl]methyl N,N-diethylcarbamodithioate (PubChem CID 8818959) has the molecular formula C17H26N4O2S3 and a molecular weight of 414.62 g/mol. Its IUPAC name is [5-(dimethylsulfamoyl)-1-ethylbenzimidazol-2-yl]methyl N,N-diethylcarbamodithioate.
| Compound Name | [5-(dimethylsulfamoyl)-1-ethylbenzimidazol-2-yl]methyl N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 8818959 |
| Molecular Formula | C17H26N4O2S3 |
| Molecular Weight | 414.62 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | [5-(dimethylsulfamoyl)-1-ethylbenzimidazol-2-yl]methyl N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)SCc1nc2cc(S(=O)(=O)N(C)C)ccc2n1CC |
| InChI | InChI=1S/C17H26N4O2S3/c1-6-20(7-2)17(24)25-12-16-18-14-11-13(26(22,23)19(4)5)9-10-15(14)21(16)8-3/h9-11H,6-8,12H2,1-5H3 |
| InChIKey | HMWPHSPIRYUWSL-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.62 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|